PATH:
home
/
lab2454c
/
bullionmills.com
/
wp-content
/
themes
/
oceanwp
/
assets
/
js
/
third
/*! * Javascript nicescroll version 3.6.8 * http://nicescroll.areaaperta.com/ * https://github.com/inuyaksa/jquery.nicescroll * * copyright 2016-02-29 InuYaksa*2016 * Released under the MIT license */ (function(factory) { if (typeof define === 'function' && define.amd) { // AMD. Register as anonymous module. define(['jquery'], factory); } else if (typeof exports === 'object') { // Node/CommonJS. module.exports = factory(require('jquery')); } else { // Browser globals. factory(jQuery); } }(function(jQuery) { "use strict"; // globals var domfocus = false; var mousefocus = false; var tabindexcounter = 0; var ascrailcounter = 2000; var globalmaxzindex = 0; var $ = jQuery; // sandbox // http://stackoverflow.com/questions/2161159/get-script-path function getScriptPath() { var scripts = document.getElementsByTagName('script'); var path = scripts.length ? scripts[scripts.length - 1].src.split('?')[0] : ''; return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : ''; } var vendors = ['webkit','ms','moz','o']; var setAnimationFrame = window.requestAnimationFrame || false; var clearAnimationFrame = window.cancelAnimationFrame || false; if (!setAnimationFrame) { // legacy detection for (var vx in vendors) { var v = vendors[vx]; setAnimationFrame = window[v + 'RequestAnimationFrame']; if (setAnimationFrame) { clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame']; break; } } } var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false; var _globaloptions = { zindex: "auto", cursoropacitymin: 0, cursoropacitymax: 1, cursorcolor: "#424242", cursorwidth: "6px", cursorborder: "1px solid #fff", cursorborderradius: "5px", scrollspeed: 60, mousescrollstep: 8 * 3, touchbehavior: false, hwacceleration: true, usetransition: true, boxzoom: false, dblclickzoom: true, gesturezoom: true, grabcursorenabled: true, autohidemode: true, background: "", iframeautoresize: true, cursorminheight: 32, preservenativescrolling: true, railoffset: false, railhoffset: false, bouncescroll: true, spacebarenabled: true, railpadding: { top: 0, right: 0, left: 0, bottom: 0 }, disableoutline: true, horizrailenabled: true, railalign: "right", railvalign: "bottom", enabletranslate3d: true, enablemousewheel: true, enablekeyboard: true, smoothscroll: true, sensitiverail: true, enablemouselockapi: true, // cursormaxheight:false, cursorfixedheight: false, directionlockdeadzone: 6, hidecursordelay: 400, nativeparentscrolling: true, enablescrollonselection: true, overflowx: true, overflowy: true, cursordragspeed: 0.3, rtlmode: "auto", cursordragontouch: false, oneaxismousemode: "auto", scriptpath: getScriptPath(), preventmultitouchscrolling: true, disablemutationobserver:false }; var browserdetected = false; var getBrowserDetection = function() { if (browserdetected) return browserdetected; var _el = document.createElement('DIV'), _style = _el.style, _agent = navigator.userAgent, _platform = navigator.platform, d = {}; d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document; d.isopera = ("opera" in window); // 12- d.isopera12 = (d.isopera && ("getUserMedia" in navigator)); d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]"); d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10- d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7)); d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8); d.isie9 = d.isie && ("performance" in window) && (document.documentMode == 9); d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10); d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+ d.isieedge12 = (navigator.userAgent.match(/Edge\/12\./)); // IE Edge 12 d.isieedge = ("msOverflowStyle" in _el); // IE Edge d.ismodernie = d.isie11 || d.isieedge; d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango if (d.isie9mobile) d.isie9 = false; d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0 d.ismozilla = ("MozAppearance" in _style); d.iswebkit = ("WebkitAppearance" in _style); d.ischrome = ("chrome" in window); d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation d.ischrome22 = (!d.ischrome38)&&(d.ischrome && d.haspointerlock); d.ischrome26 = (!d.ischrome38)&&(d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix) d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // with detection for Chrome Touch Emulation d.hasw3ctouch = (window.PointerEvent || false) && ((navigator.MaxTouchPoints > 0)||(navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec d.hasmstouch = (!d.hasw3ctouch)&&(window.MSPointerEvent || false); // IE10 pointer events d.ismac = /^mac$/i.test(_platform); d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform)); d.isios4 = ((d.isios) && !("seal" in Object)); d.isios7 = ((d.isios)&&("webkitHidden" in document)); //iOS 7+ d.isios8 = ((d.isios)&&("hidden" in document)); //iOS 8+ d.isandroid = (/android/i.test(_agent)); d.haseventlistener = ("addEventListener" in _el); d.trstyle = false; d.hastransform = false; d.hastranslate3d = false; d.transitionstyle = false; d.hastransition = false; d.transitionend = false; var a; var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform']; for (a = 0; a < check.length; a++) { if (_style[check[a]] !== undefined) { d.trstyle = check[a]; break; } } d.hastransform = (!!d.trstyle); if (d.hastransform) { _style[d.trstyle] = "translate3d(1px,2px,3px)"; d.hastranslate3d = /translate3d/.test(_style[d.trstyle]); } d.transitionstyle = false; d.prefixstyle = ''; d.transitionend = false; check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition']; var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-']; var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd']; for (a = 0; a < check.length; a++) { if (check[a] in _style) { d.transitionstyle = check[a]; d.prefixstyle = prefix[a]; d.transitionend = evs[a]; break; } } if (d.ischrome26) { // always use prefix d.prefixstyle = prefix[1]; } d.hastransition = (d.transitionstyle); function detectCursorGrab() { var lst = ['grab','-webkit-grab', '-moz-grab']; if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug for (var a = 0; a < lst.length; a++) { var p = lst[a]; _style.cursor = p; if (_style.cursor == p) return p; } return 'url(//patriciaportfolio.googlecode.com/files/openhand.cur),n-resize'; // thank you google for custom cursor! } d.cursorgrabvalue = detectCursorGrab(); d.hasmousecapture = ("setCapture" in _el); d.hasMutationObserver = (ClsMutationObserver !== false); _el = null; //memory released browserdetected = d; return d; }; var NiceScrollClass = function(myopt, me) { var self = this; this.version = '3.6.8'; this.name = 'nicescroll'; this.me = me; this.opt = { doc: $("body"), win: false }; $.extend(this.opt, _globaloptions); // clone opts // Options for internal use this.opt.snapbackspeed = 80; if (myopt || false) { for (var a in self.opt) { if (myopt[a] !== undefined) self.opt[a] = myopt[a]; } } if (self.opt.disablemutationobserver) ClsMutationObserver = false; this.doc = self.opt.doc; this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : ''; this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName); this.haswrapper = (self.opt.win !== false); this.win = self.opt.win || (this.ispage ? $(window) : this.doc); this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win; this.body = $("body"); this.viewport = false; this.isfixed = false; this.iframe = false; this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME')); this.istextarea = (this.win[0].nodeName == 'TEXTAREA'); this.forcescreen = false; //force to use screen position on events this.canshowonmouseevent = (self.opt.autohidemode != "scroll"); // Events jump table this.onmousedown = false; this.onmouseup = false; this.onmousemove = false; this.onmousewheel = false; this.onkeypress = false; this.ongesturezoom = false; this.onclick = false; // Nicescroll custom events this.onscrollstart = false; this.onscrollend = false; this.onscrollcancel = false; this.onzoomin = false; this.onzoomout = false; // Let's start! this.view = false; this.page = false; this.scroll = { x: 0, y: 0 }; this.scrollratio = { x: 0, y: 0 }; this.cursorheight = 20; this.scrollvaluemax = 0; // http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical // http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode if (this.opt.rtlmode == "auto") { var target = this.win[0] == window ? this.body : this.win; var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode"); if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode == "") { this.isrtlmode = (target.css("direction") == "rtl"); this.isvertical = false; } else { this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb"); this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl"); } } else { this.isrtlmode = (this.opt.rtlmode === true); this.isvertical = false; } // this.checkrtlmode = false; this.scrollrunning = false; this.scrollmom = false; this.observer = false; // observer div changes this.observerremover = false; // observer on parent for remove detection this.observerbody = false; // observer on body for position change do { this.id = "ascrail" + (ascrailcounter++); } while (document.getElementById(this.id)); this.rail = false; this.cursor = false; this.cursorfreezed = false; this.selectiondrag = false; this.zoom = false; this.zoomactive = false; this.hasfocus = false; this.hasmousefocus = false; this.visibility = true; this.railslocked = false; // locked by resize this.locked = false; // prevent lost of locked status sets by user this.hidden = false; // rails always hidden this.cursoractive = true; // user can interact with cursors this.wheelprevented = false; //prevent mousewheel event this.overflowx = self.opt.overflowx; this.overflowy = self.opt.overflowy; this.nativescrollingarea = false; this.checkarea = 0; this.events = []; // event list for unbind this.saved = {}; // style saved this.delaylist = {}; this.synclist = {}; this.lastdeltax = 0; this.lastdeltay = 0; this.detected = getBrowserDetection(); var cap = $.extend({}, this.detected); this.canhwscroll = (cap.hastransform && self.opt.hwacceleration); this.ishwscroll = (this.canhwscroll && self.haswrapper); if (!this.isrtlmode) { this.hasreversehr = false; } else if (this.isvertical) { // RTL mode with reverse horizontal axis this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11); } else { this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11)); } this.istouchcapable = false; // desktop devices with touch screen support //## Check WebKit-based desktop with touch support //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support) if (!cap.cantouch && (cap.hasw3ctouch||cap.hasmstouch)) { // desktop device with multiple input this.istouchcapable = true; } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) { this.istouchcapable = true; // cap.cantouch = false; // parse normal desktop events } //## disable MouseLock API on user request if (!self.opt.enablemouselockapi) { cap.hasmousecapture = false; cap.haspointerlock = false; } /* deprecated this.delayed = function(name, fn, tm, lazy) { }; */ /* this.debounced = function(name, fn, tm) { if (!self) return; var dd = self.delaylist[name]; self.delaylist[name] = fn; if (!dd) { self.debouncedelayed = setTimeout(function() { if (!self) return; var fn = self.delaylist[name]; self.delaylist[name] = false; fn.call(self); }, tm); } }; */ this.debounced = function(name, fn, tm) { if (!self) return; var dd = self.delaylist[name]||false; if (!dd) { //fixed loop call fn:checkSelectionScroll //fn.call(self); self.delaylist[name] = { h: setAnimationFrame(function(){ self.delaylist[name].fn.call(self); self.delaylist[name] = false; }, tm) }; fn.call(self); } self.delaylist[name].fn = fn; }; var _onsync = false; this.synched = function(name, fn) { function requestSync() { if (_onsync) return; setAnimationFrame(function() { if (!self) return; _onsync = false; for (var nn in self.synclist) { var fn = self.synclist[nn]; if (fn) fn.call(self); self.synclist[nn] = false; } }); _onsync = true; } self.synclist[name] = fn; requestSync(); return name; }; this.unsynched = function(name) { if (self.synclist[name]) self.synclist[name] = false; }; this.css = function(el, pars) { // save & set for (var n in pars) { self.saved.css.push([el, n, el.css(n)]); el.css(n, pars[n]); } }; this.scrollTop = function(val) { return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val); }; this.scrollLeft = function(val) { return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val); }; // derived by by Dan Pupius www.pupius.net var BezierClass = function(st, ed, spd, p1, p2, p3, p4) { this.st = st; this.ed = ed; this.spd = spd; this.p1 = p1 || 0; this.p2 = p2 || 1; this.p3 = p3 || 0; this.p4 = p4 || 1; this.ts = (new Date()).getTime(); this.df = this.ed - this.st; }; BezierClass.prototype = { B2: function(t) { return 3 * t * t * (1 - t); }, B3: function(t) { return 3 * t * (1 - t) * (1 - t); }, B4: function(t) { return (1 - t) * (1 - t) * (1 - t); }, getNow: function() { var nw = (new Date()).getTime(); var pc = 1 - ((nw - this.ts) / this.spd); var bz = this.B2(pc) + this.B3(pc) + this.B4(pc); return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz); }, update: function(ed, spd) { this.st = this.getNow(); this.ed = ed; this.spd = spd; this.ts = (new Date()).getTime(); this.df = this.ed - this.st; return this; } }; //derived from http://stackoverflow.com/questions/11236090/ function getMatrixValues() { var tr = self.doc.css(cap.trstyle); if (tr && (tr.substr(0, 6) == "matrix")) { return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/); } return false; } if (this.ishwscroll) { // hw accelerated scroll this.doc.translate = { x: 0, y: 0, tx: "0px", ty: "0px" }; //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/ if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/ this.getScrollTop = function(last) { if (!last) { var mtx = getMatrixValues(); if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10 if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow(); } return self.doc.translate.y; }; this.getScrollLeft = function(last) { if (!last) { var mtx = getMatrixValues(); if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10 if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow(); } return self.doc.translate.x; }; this.notifyScrollEvent = function(el) { var e = document.createEvent("UIEvents"); e.initUIEvent("scroll", false, true, window, 1); e.niceevent = true; el.dispatchEvent(e); }; var cxscrollleft = (this.isrtlmode) ? 1 : -1; if (cap.hastranslate3d && self.opt.enabletranslate3d) { this.setScrollTop = function(val, silent) { self.doc.translate.y = val; self.doc.translate.ty = (val * -1) + "px"; self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)"); if (!silent) self.notifyScrollEvent(self.win[0]); }; this.setScrollLeft = function(val, silent) { self.doc.translate.x = val; self.doc.translate.tx = (val * cxscrollleft) + "px"; self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)"); if (!silent) self.notifyScrollEvent(self.win[0]); }; } else { this.setScrollTop = function(val, silent) { self.doc.translate.y = val; self.doc.translate.ty = (val * -1) + "px"; self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")"); if (!silent) self.notifyScrollEvent(self.win[0]); }; this.setScrollLeft = function(val, silent) { self.doc.translate.x = val; self.doc.translate.tx = (val * cxscrollleft) + "px"; self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")"); if (!silent) self.notifyScrollEvent(self.win[0]); }; } } else { // native scroll this.getScrollTop = function() { return self.docscroll.scrollTop(); }; this.setScrollTop = function(val) { return setTimeout(function() {(self)&&self.docscroll.scrollTop(val)}, 1); }; this.getScrollLeft = function() { var val; if (!self.hasreversehr) { val = self.docscroll.scrollLeft(); } else if (self.detected.ismozilla) { val = self.page.maxw - Math.abs(self.docscroll.scrollLeft()); } else { val = self.page.maxw - self.docscroll.scrollLeft(); } return val; }; this.setScrollLeft = function(val) { return setTimeout(function() { if (!self) return; if (self.hasreversehr) { if (self.detected.ismozilla) { val = -(self.page.maxw - val); } else { val = self.page.maxw - val; } } return self.docscroll.scrollLeft(val); }, 1); }; } this.getTarget = function(e) { if (!e) return false; if (e.target) return e.target; if (e.srcElement) return e.srcElement; return false; }; this.hasParent = function(e, id) { if (!e) return false; var el = e.target || e.srcElement || e || false; while (el && el.id != id) { el = el.parentNode || false; } return (el !== false); }; function getZIndex() { var dom = self.win; if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available while (dom.length > 0) { if (dom[0].nodeType == 9) return false; var zi = dom.css('zIndex'); if (!isNaN(zi) && zi != 0) return parseInt(zi); dom = dom.parent(); } return false; } //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie var _convertBorderWidth = { "thin": 1, "medium": 3, "thick": 5 }; function getWidthToPixel(dom, prop, chkheight) { var wd = dom.css(prop); var px = parseFloat(wd); if (isNaN(px)) { px = _convertBorderWidth[wd] || 0; var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS if (self.isie8 && px) px += 1; return (brd) ? px : 0; } return px; } this.getDocumentScrollOffset = function() { return { top: window.pageYOffset || document.documentElement.scrollTop, left: window.pageXOffset || document.documentElement.scrollLeft }; }; this.getOffset = function() { if (self.isfixed) { var ofs = self.win.offset(); // fix Chrome auto issue (when right/bottom props only) var scrl = self.getDocumentScrollOffset(); ofs.top-=scrl.top; ofs.left-=scrl.left; return ofs; } var ww = self.win.offset(); if (!self.viewport) return ww; var vp = self.viewport.offset(); return { top: ww.top - vp.top,// + self.viewport.scrollTop(), left: ww.left - vp.left // + self.viewport.scrollLeft() }; }; this.updateScrollBar = function(len) { var pos, off; if (self.ishwscroll) { self.rail.css({ //** height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom) }); if (self.railh) self.railh.css({ //** width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right) }); } else { var wpos = self.getOffset(); pos = { top: wpos.top, left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right) }; pos.top += getWidthToPixel(self.win, 'border-top-width', true); pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width'); off = self.opt.railoffset; if (off) { if (off.top) pos.top += off.top; if (off.left) pos.left += off.left; } if (!self.railslocked) self.rail.css({ top: pos.top, left: pos.left, height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom) }); if (self.zoom) { self.zoom.css({ top: pos.top + 1, left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4 }); } if (self.railh && !self.railslocked) { pos = { top: wpos.top, left: wpos.left }; off = self.opt.railhoffset; if (off) { if (off.top) pos.top += off.top; if (off.left) pos.left += off.left; } var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true); var x = pos.left + getWidthToPixel(self.win, 'border-left-width'); self.railh.css({ top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom), left: x, width: self.railh.width }); } } }; this.doRailClick = function(e, dbl, hr) { var fn, pg, cur, pos; if (self.railslocked) return; self.cancelEvent(e); if (dbl) { fn = (hr) ? self.doScrollLeft : self.doScrollTop; cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y); fn(cur); } else { fn = (hr) ? self.doScrollLeftBy : self.doScrollBy; cur = (hr) ? self.scroll.x : self.scroll.y; pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top; pg = (hr) ? self.view.w : self.view.h; fn((cur >= pos) ? pg: -pg);// (cur >= pos) ? fn(pg): fn(-pg); } }; self.hasanimationframe = (setAnimationFrame); self.hascancelanimationframe = (clearAnimationFrame); if (!self.hasanimationframe) { setAnimationFrame = function(fn) { return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16); }; // 1000/60)}; clearAnimationFrame = clearTimeout; } else if (!self.hascancelanimationframe) clearAnimationFrame = function() { self.cancelAnimationFrame = true; }; this.init = function() { self.saved.css = []; if (cap.isie7mobile) return true; // SORRY, DO NOT WORK! if (cap.isoperamini) return true; // SORRY, DO NOT WORK! var _touchaction = (cap.isie10) ? '-ms-touch-action' : 'touch-action'; if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, { _touchaction: 'none' }); var _scrollyhidden = (cap.ismodernie||cap.isie10) ? {'-ms-overflow-style':'none'} : {'overflow-y':'hidden'}; // IE is always a world apart! self.zindex = "auto"; if (!self.ispage && self.opt.zindex == "auto") { self.zindex = getZIndex() || "auto"; } else { self.zindex = self.opt.zindex; } if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) { globalmaxzindex = self.zindex; } if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0 self.zindex = "auto"; } if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) { var cont = self.docscroll; if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc; if (!cap.isie9mobile) self.css(cont, _scrollyhidden); if (self.ispage && cap.isie7) { if (self.doc[0].nodeName == 'BODY') self.css($("html"), { 'overflow-y': 'hidden' }); //IE7 double scrollbar issue else if (self.doc[0].nodeName == 'HTML') self.css($("body"), _scrollyhidden); //IE7 double scrollbar issue } if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), { "-webkit-overflow-scrolling": "touch" }); //force hw acceleration var cursor = $(document.createElement('div')); cursor.css({ position: "relative", top: 0, "float": "right", width: self.opt.cursorwidth, height: 0, 'background-color': self.opt.cursorcolor, border: self.opt.cursorborder, 'background-clip': 'padding-box', '-webkit-border-radius': self.opt.cursorborderradius, '-moz-border-radius': self.opt.cursorborderradius, 'border-radius': self.opt.cursorborderradius }); cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight()); cursor.addClass('nicescroll-cursors'); self.cursor = cursor; var rail = $(document.createElement('div')); rail.attr('id', self.id); rail.addClass('nicescroll-rails nicescroll-rails-vr'); var v, a, kp = ["left","right","top","bottom"]; //** for (var n in kp) { a = kp[n]; v = self.opt.railpadding[a]; (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0; } rail.append(cursor); rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth()); rail.css({ width: rail.width + "px", zIndex: self.zindex, background: self.opt.background, cursor: "default" }); rail.visibility = true; rail.scrollable = true; rail.align = (self.opt.railalign == "left") ? 0 : 1; self.rail = rail; self.rail.drag = false; var zoom = false; if (self.opt.boxzoom && !self.ispage && !cap.isieold) { zoom = document.createElement('div'); self.bind(zoom, "click", self.doZoom); self.bind(zoom, "mouseenter", function() { self.zoom.css('opacity', self.opt.cursoropacitymax); }); self.bind(zoom, "mouseleave", function() { self.zoom.css('opacity', self.opt.cursoropacitymin); }); self.zoom = $(zoom); self.zoom.css({ cursor: "pointer", zIndex: self.zindex, backgroundImage: 'url(' + self.opt.scriptpath + 'zoomico.png)', height: 18, width: 18, backgroundPosition: '0px 0px' }); if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom); if (cap.cantouch && self.opt.gesturezoom) { self.ongesturezoom = function(e) { if (e.scale > 1.5) self.doZoomIn(e); if (e.scale < 0.8) self.doZoomOut(e); return self.cancelEvent(e); }; self.bind(self.win, "gestureend", self.ongesturezoom); } } // init HORIZ self.railh = false; var railh; if (self.opt.horizrailenabled) { self.css(cont, { overflowX: 'hidden' }); var cursor = $(document.createElement('div')); cursor.css({ position: "absolute", top: 0, height: self.opt.cursorwidth, width: 0, backgroundColor: self.opt.cursorcolor, border: self.opt.cursorborder, backgroundClip: 'padding-box', '-webkit-border-radius': self.opt.cursorborderradius, '-moz-border-radius': self.opt.cursorborderradius, 'border-radius': self.opt.cursorborderradius }); if (cap.isieold) cursor.css('overflow', 'hidden'); //IE6 horiz scrollbar issue cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth()); cursor.addClass('nicescroll-cursors'); self.cursorh = cursor; railh = $(document.createElement('div')); railh.attr('id', self.id + '-hr'); railh.addClass('nicescroll-rails nicescroll-rails-hr'); railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight()); railh.css({ height: railh.height + "px", 'zIndex': self.zindex, "background": self.opt.background }); railh.append(cursor); railh.visibility = true; railh.scrollable = true; railh.align = (self.opt.railvalign == "top") ? 0 : 1; self.railh = railh; self.railh.drag = false; } // if (self.ispage) { rail.css({ position: "fixed", top: 0, height: "100%" }); (rail.align) ? rail.css({ right: 0 }): rail.css({ left: 0 }); self.body.append(rail); if (self.railh) { railh.css({ position: "fixed", left: 0, width: "100%" }); (railh.align) ? railh.css({ bottom: 0 }): railh.css({ top: 0 }); self.body.append(railh); } } else { if (self.ishwscroll) { if (self.win.css('position') == 'static') self.css(self.win, { 'position': 'relative' }); var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win; $(bd).scrollTop(0).scrollLeft(0); // fix rail position if content already scrolled if (self.zoom) { self.zoom.css({ position: "absolute", top: 1, right: 0, "margin-right": rail.width + 4 }); bd.append(self.zoom); } rail.css({ position: "absolute", top: 0 }); (rail.align) ? rail.css({ right: 0 }): rail.css({ left: 0 }); bd.append(rail); if (railh) { railh.css({ position: "absolute", left: 0, bottom: 0 }); (railh.align) ? railh.css({ bottom: 0 }): railh.css({ top: 0 }); bd.append(railh); } } else { self.isfixed = (self.win.css("position") == "fixed"); var rlpos = (self.isfixed) ? "fixed" : "absolute"; if (!self.isfixed) self.viewport = self.getViewport(self.win[0]); if (self.viewport) { self.body = self.viewport; if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, { "position": "relative" }); } rail.css({ position: rlpos }); if (self.zoom) self.zoom.css({ position: rlpos }); self.updateScrollBar(); self.body.append(rail); if (self.zoom) self.body.append(self.zoom); if (self.railh) { railh.css({ position: rlpos }); self.body.append(railh); } } if (cap.isios) self.css(self.win, { '-webkit-tap-highlight-color': 'rgba(0,0,0,0)', '-webkit-touch-callout': 'none' }); // prevent grey layer on click if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div if (cap.iswebkit && self.opt.disableoutline) self.win.css('outline', 'none'); // Webkit outline //if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera 12- to test [TODO] } if (self.opt.autohidemode === false) { self.autohidedom = false; self.rail.css({ opacity: self.opt.cursoropacitymax }); if (self.railh) self.railh.css({ opacity: self.opt.cursoropacitymax }); } else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) { self.autohidedom = $().add(self.rail); if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor); if (self.railh) self.autohidedom = self.autohidedom.add(self.railh); if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh); } else if (self.opt.autohidemode == "scroll") { self.autohidedom = $().add(self.rail); if (self.railh) self.autohidedom = self.autohidedom.add(self.railh); } else if (self.opt.autohidemode == "cursor") { self.autohidedom = $().add(self.cursor); if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh); } else if (self.opt.autohidemode == "hidden") { self.autohidedom = false; self.hide(); self.railslocked = false; } if (cap.isie9mobile) { self.scrollmom = new ScrollMomentumClass2D(self); self.onmangotouch = function() { var py = self.getScrollTop(); var px = self.getScrollLeft(); if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true; var dfy = py - self.mangotouch.sy; var dfx = px - self.mangotouch.sx; var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2))); if (df == 0) return; var dry = (dfy < 0) ? -1 : 1; var drx = (dfx < 0) ? -1 : 1; var tm = +new Date(); if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy); if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) { self.scrollmom.stop(); self.scrollmom.reset(px, py); self.mangotouch.sy = py; self.mangotouch.ly = py; self.mangotouch.sx = px; self.mangotouch.lx = px; self.mangotouch.dry = dry; self.mangotouch.drx = drx; self.mangotouch.tm = tm; } else { self.scrollmom.stop(); self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy); self.mangotouch.tm = tm; var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px)); self.mangotouch.ly = py; self.mangotouch.lx = px; if (ds > 2) { self.mangotouch.lazy = setTimeout(function() { self.mangotouch.lazy = false; self.mangotouch.dry = 0; self.mangotouch.drx = 0; self.mangotouch.tm = 0; self.scrollmom.doMomentum(30); }, 100); } } }; var top = self.getScrollTop(); var lef = self.getScrollLeft(); self.mangotouch = { sy: top, ly: top, dry: 0, sx: lef, lx: lef, drx: 0, lazy: false, tm: 0 }; self.bind(self.docscroll, "scroll", self.onmangotouch); } else { if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) { self.scrollmom = new ScrollMomentumClass2D(self); self.ontouchstart = function(e) { if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false; self.hasmoving = false; if (!self.railslocked) { var tg; if (cap.hasmstouch) { tg = (e.target) ? e.target : false; while (tg) { var nc = $(tg).getNiceScroll(); if ((nc.length > 0) && (nc[0].me == self.me)) break; if (nc.length > 0) return false; if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break; tg = (tg.parentNode) ? tg.parentNode : false; } } self.cancelScroll(); tg = self.getTarget(e); if (tg) { var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type)); if (skp) return self.stopPropagation(e); } if (!("clientX" in e) && ("changedTouches" in e)) { e.clientX = e.changedTouches[0].clientX; e.clientY = e.changedTouches[0].clientY; } if (self.forcescreen) { var le = e; e = { "original": (e.original) ? e.original : e }; e.clientX = le.screenX; e.clientY = le.screenY; } self.rail.drag = { x: e.clientX, y: e.clientY, sx: self.scroll.x, sy: self.scroll.y, st: self.getScrollTop(), sl: self.getScrollLeft(), pt: 2, dl: false }; if (self.ispage || !self.opt.directionlockdeadzone) { self.rail.drag.dl = "f"; } else { var view = { w: $(window).width(), h: $(window).height() }; var page = { w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth), h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight) }; var maxh = Math.max(0, page.h - view.h); var maxw = Math.max(0, page.w - view.w); if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false; else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false; else self.rail.drag.ck = false; if (!self.rail.drag.ck) self.rail.drag.dl = "f"; } if (self.opt.touchbehavior && self.isiframe && cap.isie) { var wp = self.win.position(); self.rail.drag.x += wp.left; self.rail.drag.y += wp.top; } self.hasmoving = false; self.lastmouseup = false; self.scrollmom.reset(e.clientX, e.clientY); if (!cap.cantouch && !this.istouchcapable && !e.pointerType) { var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false; if (!ip) { if (!self.ispage && cap.hasmousecapture) tg.setCapture(); if (self.opt.touchbehavior) { if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event tg._onclick = tg.onclick; tg.onclick = function(e) { if (self.hasmoving) return false; tg._onclick.call(this, e); }; } return self.cancelEvent(e); } return self.stopPropagation(e); } if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) { self.preventclick = { "tg": tg, "click": false }; } } } }; self.ontouchend = function(e) { if (!self.rail.drag) return true; if (self.rail.drag.pt == 2) { if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false; self.scrollmom.doMomentum(); self.rail.drag = false; if (self.hasmoving) { self.lastmouseup = true; self.hideCursor(); if (cap.hasmousecapture) document.releaseCapture(); if (!cap.cantouch) return self.cancelEvent(e); } } else if (self.rail.drag.pt == 1) { return self.onmouseup(e); } }; var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture); self.ontouchmove = function(e, byiframe) { if (!self.rail.drag) return false; if (e.targetTouches && self.opt.preventmultitouchscrolling) { if (e.targetTouches.length > 1) return false; // multitouch } if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false; if (self.rail.drag.pt == 2) { if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements self.hasmoving = true; if (self.preventclick && !self.preventclick.click) { self.preventclick.click = self.preventclick.tg.onclick || false; self.preventclick.tg.onclick = self.onpreventclick; } var ev = $.extend({ "original": e }, e); e = ev; if (("changedTouches" in e)) { e.clientX = e.changedTouches[0].clientX; e.clientY = e.changedTouches[0].clientY; } if (self.forcescreen) { var le = e; e = { "original": (e.original) ? e.original : e }; e.clientX = le.screenX; e.clientY = le.screenY; } var ofy,ofx; ofx = ofy = 0; if (moveneedoffset && !byiframe) { var wp = self.win.position(); ofx = -wp.left; ofy = -wp.top; } var fy = e.clientY + ofy; var my = (fy - self.rail.drag.y); var fx = e.clientX + ofx; var mx = (fx - self.rail.drag.x); var ny = self.rail.drag.st - my; if (self.ishwscroll && self.opt.bouncescroll) { if (ny < 0) { ny = Math.round(ny / 2); // fy = 0; } else if (ny > self.page.maxh) { ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2); // fy = 0; } } else { if (ny < 0) { ny = 0; fy = 0; } if (ny > self.page.maxh) { ny = self.page.maxh; fy = 0; } } var nx; if (self.railh && self.railh.scrollable) { nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx; if (self.ishwscroll && self.opt.bouncescroll) { if (nx < 0) { nx = Math.round(nx / 2); // fx = 0; } else if (nx > self.page.maxw) { nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2); // fx = 0; } } else { if (nx < 0) { nx = 0; fx = 0; } if (nx > self.page.maxw) { nx = self.page.maxw; fx = 0; } } } var grabbed = false; if (self.rail.drag.dl) { grabbed = true; if (self.rail.drag.dl == "v") nx = self.rail.drag.sl; else if (self.rail.drag.dl == "h") ny = self.rail.drag.st; } else { var ay = Math.abs(my); var ax = Math.abs(mx); var dz = self.opt.directionlockdeadzone; if (self.rail.drag.ck == "v") { if (ay > dz && (ax <= (ay * 0.3))) { self.rail.drag = false; return true; } else if (ax > dz) { self.rail.drag.dl = "f"; $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked) } } else if (self.rail.drag.ck == "h") { if (ax > dz && (ay <= (ax * 0.3))) { self.rail.drag = false; return true; } else if (ay > dz) { self.rail.drag.dl = "f"; $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked) } } } self.synched("touchmove", function() { if (self.rail.drag && (self.rail.drag.pt == 2)) { if (self.prepareTransition) self.prepareTransition(0); if (self.rail.scrollable) self.setScrollTop(ny); self.scrollmom.update(fx, fy); if (self.railh && self.railh.scrollable) { self.setScrollLeft(nx); self.showCursor(ny, nx); } else { self.showCursor(ny); } if (cap.isie10) document.selection.clear(); } }); if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like! if (grabbed) return self.cancelEvent(e); } else if (self.rail.drag.pt == 1) { // drag on cursor return self.onmousemove(e); } }; self.ontouchstartCursor = function (e, hronly) { if (self.rail.drag && self.rail.drag.pt != 3) return; if (self.locked) return self.cancelEvent(e); self.cancelScroll(); self.rail.drag = { x: e.touches[0].clientX, y: e.touches[0].clientY, sx: self.scroll.x, sy: self.scroll.y, pt: 3, hr: (!!hronly) }; var tg = self.getTarget(e); if (!self.ispage && cap.hasmousecapture) tg.setCapture(); if (self.isiframe && !cap.hasmousecapture) { self.saved["csspointerevents"] = self.doc.css("pointer-events"); self.css(self.doc, {"pointer-events": "none"}); } return self.cancelEvent(e); }; self.ontouchendCursor = function (e) { if (self.rail.drag) { if (cap.hasmousecapture) document.releaseCapture(); if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved["csspointerevents"]); if (self.rail.drag.pt != 3)return; self.rail.drag = false; //if (!self.rail.active) self.hideCursor(); return self.cancelEvent(e); } }; self.ontouchmoveCursor = function (e) { if (self.rail.drag) { if (self.rail.drag.pt != 3)return; self.cursorfreezed = true; if (self.rail.drag.hr) { self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x); if (self.scroll.x < 0) self.scroll.x = 0; var mw = self.scrollvaluemaxw; if (self.scroll.x > mw) self.scroll.x = mw; } else { self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y); if (self.scroll.y < 0) self.scroll.y = 0; var my = self.scrollvaluemax; if (self.scroll.y > my) self.scroll.y = my; } self.synched('touchmove', function () { if (self.rail.drag && (self.rail.drag.pt == 3)) { self.showCursor(); if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed); else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed); } }); return self.cancelEvent(e); } /* else { self.checkarea = true; } */ }; } self.onmousedown = function(e, hronly) { if (self.rail.drag && self.rail.drag.pt != 1) return; if (self.railslocked) return self.cancelEvent(e); self.cancelScroll(); self.rail.drag = { x: e.clientX, y: e.clientY, sx: self.scroll.x, sy: self.scroll.y, pt: 1, hr: (!!hronly) }; var tg = self.getTarget(e); if (!self.ispage && cap.hasmousecapture) tg.setCapture(); if (self.isiframe && !cap.hasmousecapture) { self.saved.csspointerevents = self.doc.css("pointer-events"); self.css(self.doc, { "pointer-events": "none" }); } self.hasmoving = false; return self.cancelEvent(e); }; self.onmouseup = function(e) { if (self.rail.drag) { if (self.rail.drag.pt != 1) return true; if (cap.hasmousecapture) document.releaseCapture(); if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents); self.rail.drag = false; //if (!self.rail.active) self.hideCursor(); if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning return self.cancelEvent(e); } }; self.onmousemove = function(e) { if (self.rail.drag) { if (self.rail.drag.pt != 1) return; if (cap.ischrome && e.which == 0) return self.onmouseup(e); self.cursorfreezed = true; self.hasmoving = true; if (self.rail.drag.hr) { self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x); if (self.scroll.x < 0) self.scroll.x = 0; var mw = self.scrollvaluemaxw; if (self.scroll.x > mw) self.scroll.x = mw; } else { self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y); if (self.scroll.y < 0) self.scroll.y = 0; var my = self.scrollvaluemax; if (self.scroll.y > my) self.scroll.y = my; } self.synched('mousemove', function() { if (self.rail.drag && (self.rail.drag.pt == 1)) { self.showCursor(); if (self.rail.drag.hr) { if (self.hasreversehr) { self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed); } else { self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed); } } else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed); } }); return self.cancelEvent(e); } else { self.checkarea = 0; } }; if (cap.cantouch || self.opt.touchbehavior) { self.onpreventclick = function(e) { if (self.preventclick) { self.preventclick.tg.onclick = self.preventclick.click; self.preventclick = false; return self.cancelEvent(e); } }; self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging self.onclick = (cap.isios) ? false : function(e) { // it needs to check IE11 ??? if (self.lastmouseup) { self.lastmouseup = false; return self.cancelEvent(e); } else { return true; } }; if (self.opt.grabcursorenabled && cap.cursorgrabvalue) { self.css((self.ispage) ? self.doc : self.win, { 'cursor': cap.cursorgrabvalue }); self.css(self.rail, { 'cursor': cap.cursorgrabvalue }); } } else { var checkSelectionScroll = function(e) { if (!self.selectiondrag) return; if (e) { var ww = self.win.outerHeight(); var df = (e.pageY - self.selectiondrag.top); if (df > 0 && df < ww) df = 0; if (df >= ww) df -= ww; self.selectiondrag.df = df; } if (self.selectiondrag.df == 0) return; var rt = -Math.floor(self.selectiondrag.df / 6) * 2; self.doScrollBy(rt); self.debounced("doselectionscroll", function() { checkSelectionScroll(); }, 50); }; if ("getSelection" in document) { // A grade - Major browsers self.hasTextSelected = function() { return (document.getSelection().rangeCount > 0); }; } else if ("selection" in document) { //IE9- self.hasTextSelected = function() { return (document.selection.type != "None"); }; } else { self.hasTextSelected = function() { // no support return false; }; } self.onselectionstart = function(e) { /* More testing - severe chrome issues if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling self.win.css({'overflow':'auto'}); setTimeout(function(){ self.win.css({'overflow':''}); },10); return true; } */ if (self.ispage) return; self.selectiondrag = self.win.offset(); }; self.onselectionend = function(e) { self.selectiondrag = false; }; self.onselectiondrag = function(e) { if (!self.selectiondrag) return; if (self.hasTextSelected()) self.debounced("selectionscroll", function() { checkSelectionScroll(e); }, 250); }; } if (cap.hasw3ctouch) { //IE11+ self.css(self.rail, { 'touch-action': 'none' }); self.css(self.cursor, { 'touch-action': 'none' }); self.bind(self.win, "pointerdown", self.ontouchstart); self.bind(document, "pointerup", self.ontouchend); self.bind(document, "pointermove", self.ontouchmove); } else if (cap.hasmstouch) { //IE10 self.css(self.rail, { '-ms-touch-action': 'none' }); self.css(self.cursor, { '-ms-touch-action': 'none' }); self.bind(self.win, "MSPointerDown", self.ontouchstart); self.bind(document, "MSPointerUp", self.ontouchend); self.bind(document, "MSPointerMove", self.ontouchmove); self.bind(self.cursor, "MSGestureHold", function(e) { e.preventDefault(); }); self.bind(self.cursor, "contextmenu", function(e) { e.preventDefault(); }); } else if (this.istouchcapable) { //desktop with screen touch enabled self.bind(self.win, "touchstart", self.ontouchstart); self.bind(document, "touchend", self.ontouchend); self.bind(document, "touchcancel", self.ontouchend); self.bind(document, "touchmove", self.ontouchmove); } if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) { self.rail.css({ cursor: "default" }); self.railh && self.railh.css({ cursor: "default" }); self.jqbind(self.rail, "mouseenter", function() { if (!self.ispage && !self.win.is(":visible")) return false; if (self.canshowonmouseevent) self.showCursor(); self.rail.active = true; }); self.jqbind(self.rail, "mouseleave", function() { self.rail.active = false; if (!self.rail.drag) self.hideCursor(); }); if (self.opt.sensitiverail) { self.bind(self.rail, "click", function(e) { self.doRailClick(e, false, false); }); self.bind(self.rail, "dblclick", function(e) { self.doRailClick(e, true, false); }); self.bind(self.cursor, "click", function(e) { self.cancelEvent(e); }); self.bind(self.cursor, "dblclick", function(e) { self.cancelEvent(e); }); } if (self.railh) { self.jqbind(self.railh, "mouseenter", function() { if (!self.ispage && !self.win.is(":visible")) return false; if (self.canshowonmouseevent) self.showCursor(); self.rail.active = true; }); self.jqbind(self.railh, "mouseleave", function() { self.rail.active = false; if (!self.rail.drag) self.hideCursor(); }); if (self.opt.sensitiverail) { self.bind(self.railh, "click", function(e) { self.doRailClick(e, false, true); }); self.bind(self.railh, "dblclick", function(e) { self.doRailClick(e, true, true); }); self.bind(self.cursorh, "click", function(e) { self.cancelEvent(e); }); self.bind(self.cursorh, "dblclick", function(e) { self.cancelEvent(e); }); } } } if(self.opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) { self.bind(self.cursor, "touchstart", self.ontouchstartCursor); self.bind(self.cursor, "touchmove", self.ontouchmoveCursor); self.bind(self.cursor, "touchend", self.ontouchendCursor); self.cursorh && self.bind(self.cursorh, "touchstart", function(e) { self.ontouchstartCursor(e, true); }); self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor); self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor); } if (!cap.cantouch && !self.opt.touchbehavior) { self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup); self.bind(document, "mousemove", self.onmousemove); if (self.onclick) self.bind(document, "click", self.onclick); self.bind(self.cursor, "mousedown", self.onmousedown); self.bind(self.cursor, "mouseup", self.onmouseup); if (self.railh) { self.bind(self.cursorh, "mousedown", function(e) { self.onmousedown(e, true); }); self.bind(self.cursorh, "mouseup", self.onmouseup); } if (!self.ispage && self.opt.enablescrollonselection) { self.bind(self.win[0], "mousedown", self.onselectionstart); self.bind(document, "mouseup", self.onselectionend); self.bind(self.cursor, "mouseup", self.onselectionend); if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend); self.bind(document, "mousemove", self.onselectiondrag); } if (self.zoom) { self.jqbind(self.zoom, "mouseenter", function() { if (self.canshowonmouseevent) self.showCursor(); self.rail.active = true; }); self.jqbind(self.zoom, "mouseleave", function() { self.rail.active = false; if (!self.rail.drag) self.hideCursor(); }); } } else { self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend); self.bind(document, "mousemove", self.ontouchmove); if (self.onclick) self.bind(document, "click", self.onclick); if (self.opt.cursordragontouch) { self.bind(self.cursor, "mousedown", self.onmousedown); self.bind(self.cursor, "mouseup", self.onmouseup); //self.bind(self.cursor, "mousemove", self.onmousemove); self.cursorh && self.bind(self.cursorh, "mousedown", function(e) { self.onmousedown(e, true); }); //self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove); self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup); } else { self.bind(self.rail, "mousedown", function(e){e.preventDefault();}); // prevent text selection self.railh&&self.bind(self.railh, "mousedown", function(e){e.preventDefault();}); } } if (self.opt.enablemousewheel) { if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? document : self.win , self.onmousewheel); self.mousewheel(self.rail, self.onmousewheel); if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr); } if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) { if (!self.win.attr("tabindex")) self.win.attr({ "tabindex": tabindexcounter++ }); self.jqbind(self.win, "focus", function(e) { domfocus = (self.getTarget(e)).id || true; self.hasfocus = true; if (self.canshowonmouseevent) self.noticeCursor(); }); self.jqbind(self.win, "blur", function(e) { domfocus = false; self.hasfocus = false; }); self.jqbind(self.win, "mouseenter", function(e) { mousefocus = (self.getTarget(e)).id || true; self.hasmousefocus = true; if (self.canshowonmouseevent) self.noticeCursor(); }); self.jqbind(self.win, "mouseleave", function() { mousefocus = false; self.hasmousefocus = false; if (!self.rail.drag) self.hideCursor(); }); } } // !ie9mobile //Thanks to http://www.quirksmode.org !! self.onkeypress = function(e) { if (self.railslocked && self.page.maxh == 0) return true; e = (e) ? e : window.e; var tg = self.getTarget(e); if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) { var tp = tg.getAttribute('type') || tg.type || false; if ((!tp) || !(/submit|button|cancel/i.tp)) return true; } if ($(tg).attr('contenteditable')) return true; if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) { var key = e.keyCode; if (self.railslocked && key != 27) return self.cancelEvent(e); var ctrl = e.ctrlKey || false; var shift = e.shiftKey || false; var ret = false; switch (key) { case 38: case 63233: //safari self.doScrollBy(24 * 3); ret = true; break; case 40: case 63235: //safari self.doScrollBy(-24 * 3); ret = true; break; case 37: case 63232: //safari if (self.railh) { (ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3); ret = true; } break; case 39: case 63234: //safari if (self.railh) { (ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3); ret = true; } break; case 33: case 63276: // safari self.doScrollBy(self.view.h); ret = true; break; case 34: case 63277: // safari self.doScrollBy(-self.view.h); ret = true; break; case 36: case 63273: // safari (self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0); ret = true; break; case 35: case 63275: // safari (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh); ret = true; break; case 32: if (self.opt.spacebarenabled) { (shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h); ret = true; } break; case 27: // ESC if (self.zoomactive) { self.doZoom(); ret = true; } break; } if (ret) return self.cancelEvent(e); } }; if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress); self.bind(document, "keydown", function(e) { var ctrl = e.ctrlKey || false; if (ctrl) self.wheelprevented = true; }); self.bind(document, "keyup", function(e) { var ctrl = e.ctrlKey || false; if (!ctrl) self.wheelprevented = false; }); self.bind(window,"blur",function(e){ self.wheelprevented = false; }); self.bind(window, 'resize', self.lazyResize); self.bind(window, 'orientationchange', self.lazyResize); self.bind(window, "load", self.lazyResize); if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26 var tmp = self.win.attr("style"); var ww = parseFloat(self.win.css("width")) + 1; self.win.css('width', ww); self.synched("chromefix", function() { self.win.attr("style", tmp); }); } // Trying a cross-browser implementation - good luck! self.onAttributeChange = function(e) { self.lazyResize(self.isieold ? 250 : 30); }; if ((!self.isie11) && (ClsMutationObserver !== false)) { // IE11 crashes #568 self.observerbody = new ClsMutationObserver(function(mutations) { mutations.forEach(function(mut){ if (mut.type=="attributes") { return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show(); // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal } }); // if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30); if (self.me.clientWidth!=self.page.width || self.me.clientHeight!=self.page.height) return self.lazyResize(30); }); self.observerbody.observe(document.body, { childList: true, subtree: true, characterData: false, attributes: true, attributeFilter: ['class'] }); } if (!self.ispage && !self.haswrapper) { // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content if (ClsMutationObserver !== false) { self.observer = new ClsMutationObserver(function(mutations) { mutations.forEach(self.onAttributeChange); }); self.observer.observe(self.win[0], { childList: true, characterData: false, attributes: true, subtree: false }); self.observerremover = new ClsMutationObserver(function(mutations) { mutations.forEach(function(mo) { if (mo.removedNodes.length > 0) { for (var dd in mo.removedNodes) { if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove(); } } }); }); self.observerremover.observe(self.win[0].parentNode, { childList: true, characterData: false, attributes: false, subtree: false }); } else { self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange); if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug self.bind(self.win, "DOMNodeRemoved", function(e) { if (e.target == self.win[0]) self.remove(); }); } } // if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom); if (self.istextarea) { self.bind(self.win, "keydown", self.lazyResize); self.bind(self.win, "mouseup", self.lazyResize); } // self.checkrtlmode = true; self.lazyResize(30); } if (this.doc[0].nodeName == 'IFRAME') { var oniframeload = function() { self.iframexd = false; var doc; try { doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document; var a = doc.domain; } catch (e) { self.iframexd = true; doc = false; } if (self.iframexd) { if ("console" in window) console.log('NiceScroll error: policy restriced iframe'); return true; //cross-domain - I can't manage this } self.forcescreen = true; if (self.isiframe) { self.iframe = { "doc": $(doc), "html": self.doc.contents().find('html')[0], "body": self.doc.contents().find('body')[0] }; self.getContentSize = function() { return { w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth), h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight) }; }; self.docscroll = $(self.iframe.body); //$(this.contentWindow); } if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) { self.win.scrollTop(0); // reset position self.doc.height(""); //reset height to fix browser bug var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight); self.doc.height(hh); } self.lazyResize(30); if (cap.isie7) self.css($(self.iframe.html), _scrollyhidden); self.css($(self.iframe.body), _scrollyhidden); if (cap.isios && self.haswrapper) { self.css($(doc.body), { '-webkit-transform': 'translate3d(0,0,0)' }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/ } if ('contentWindow' in this) { self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor } else { self.bind(doc, "scroll", self.onscroll); } if (self.opt.enablemousewheel) { self.mousewheel(doc, self.onmousewheel); } if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress); if (cap.cantouch || self.opt.touchbehavior) { self.bind(doc, "mousedown", self.ontouchstart); self.bind(doc, "mousemove", function(e) { return self.ontouchmove(e, true); }); if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), { 'cursor': cap.cursorgrabvalue }); } self.bind(doc, "mouseup", self.ontouchend); if (self.zoom) { if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom); if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom); } }; if (this.doc[0].readyState && this.doc[0].readyState == "complete") { setTimeout(function() { oniframeload.call(self.doc[0], false); }, 500); } self.bind(this.doc, "load", oniframeload); } }; this.showCursor = function(py, px) { if (self.cursortimeout) { clearTimeout(self.cursortimeout); self.cursortimeout = 0; } if (!self.rail) return; if (self.autohidedom) { self.autohidedom.stop().css({ opacity: self.opt.cursoropacitymax }); self.cursoractive = true; } if (!self.rail.drag || self.rail.drag.pt != 1) { if (py !== undefined && py !== false) { self.scroll.y = Math.round(py * 1 / self.scrollratio.y); } if (px !== undefined) { self.scroll.x = Math.round(px * 1 / self.scrollratio.x); } } self.cursor.css({ height: self.cursorheight, top: self.scroll.y }); if (self.cursorh) { var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x; (!self.rail.align && self.rail.visibility) ? self.cursorh.css({ width: self.cursorwidth, left: lx + self.rail.width }): self.cursorh.css({ width: self.cursorwidth, left: lx }); self.cursoractive = true; } if (self.zoom) self.zoom.stop().css({ opacity: self.opt.cursoropacitymax }); }; this.hideCursor = function(tm) { if (self.cursortimeout) return; if (!self.rail) return; if (!self.autohidedom) return; if (self.hasmousefocus && self.opt.autohidemode == "leave") return; self.cursortimeout = setTimeout(function() { if (!self.rail.active || !self.showonmouseevent) { self.autohidedom.stop().animate({ opacity: self.opt.cursoropacitymin }); if (self.zoom) self.zoom.stop().animate({ opacity: self.opt.cursoropacitymin }); self.cursoractive = false; } self.cursortimeout = 0; }, tm || self.opt.hidecursordelay); }; this.noticeCursor = function(tm, py, px) { self.showCursor(py, px); if (!self.rail.active) self.hideCursor(tm); }; this.getContentSize = (self.ispage) ? function() { return { w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth), h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight) }; } : (self.haswrapper) ? function() { return { w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')), h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom')) }; } : function() { return { w: self.docscroll[0].scrollWidth, h: self.docscroll[0].scrollHeight }; }; this.onResize = function(e, page) { if (!self || !self.win) return false; if (!self.haswrapper && !self.ispage) { if (self.win.css('display') == 'none') { if (self.visibility) self.hideRail().hideRailHr(); return false; } else { if (!self.hidden && !self.visibility) self.showRail().showRailHr(); } } var premaxh = self.page.maxh; var premaxw = self.page.maxw; var preview = { h: self.view.h, w: self.view.w }; self.view = { w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth), h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight) }; self.page = (page) ? page : self.getContentSize(); self.page.maxh = Math.max(0, self.page.h - self.view.h); self.page.maxw = Math.max(0, self.page.w - self.view.w); if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) { // test position if (!self.ispage) { var pos = self.win.offset(); if (self.lastposition) { var lst = self.lastposition; if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do } self.lastposition = pos; } else { return self; //nothing to do } } if (self.page.maxh == 0) { self.hideRail(); self.scrollvaluemax = 0; self.scroll.y = 0; self.scrollratio.y = 0; self.cursorheight = 0; self.setScrollTop(0); if (self.rail) self.rail.scrollable = false; } else { self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom); //** self.rail.scrollable = true; } if (self.page.maxw == 0) { self.hideRailHr(); self.scrollvaluemaxw = 0; self.scroll.x = 0; self.scrollratio.x = 0; self.cursorwidth = 0; self.setScrollLeft(0); if (self.railh) { self.railh.scrollable = false; } } else { self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right); //** if (self.railh) self.railh.scrollable = (self.opt.horizrailenabled); } self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0)); if (self.railslocked) { if (!self.ispage) self.updateScrollBar(self.view); return false; } if (!self.hidden && !self.visibility) { self.showRail().showRailHr(); } else if (self.railh && (!self.hidden && !self.railh.visibility)) self.showRailHr(); if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20; self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h))); self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight); self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w))); self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth); self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom); //** if (self.railh) { self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w; self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right); //** } /* if (self.checkrtlmode&&self.railh) { self.checkrtlmode = false; if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw); } */ if (!self.ispage) self.updateScrollBar(self.view); self.scrollratio = { x: (self.page.maxw / self.scrollvaluemaxw), y: (self.page.maxh / self.scrollvaluemax) }; var sy = self.getScrollTop(); if (sy > self.page.maxh) { self.doScrollTop(self.page.maxh); } else { self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y)); self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x)); if (self.cursoractive) self.noticeCursor(); } if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y)); return self; }; this.resize = self.onResize; this.hlazyresize = 0; this.lazyResize = function(tm) { // event debounce /* tm = (isNaN(tm)) ? 30 : tm; self.debounced('resize', self.resize, tm); */ // if (!self.haswrapper&&self.opt.autohidemode!==false) self.hide(); if (!self.haswrapper) self.hide(); if (self.hlazyresize) clearTimeout(self.hlazyresize); self.hlazyresize = setTimeout(function(){ self && self.show().resize(); },240); return self; }; // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel function _modernWheelEvent(dom, name, fn, bubble) { self._bind(dom, name, function(e) { var e = (e) ? e : window.event; var event = { original: e, target: e.target || e.srcElement, type: "wheel", deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1, deltaX: 0, deltaZ: 0, preventDefault: function() { e.preventDefault ? e.preventDefault() : e.returnValue = false; return false; }, stopImmediatePropagation: function() { (e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true; } }; if (name == "mousewheel") { e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX); e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY); !event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta); } else { event.deltaY = e.detail; } return fn.call(dom, event); }, bubble); } this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave) self.events.push({ e: dom, n: name, f: fn, q: true }); $(dom).bind(name, fn); }; this.mousewheel = function(dom, fn, bubble) { // bind mousewheel var el = ("jquery" in dom) ? dom[0] : dom; if ("onwheel" in document.createElement("div")) { // Modern browsers support "wheel" self._bind(el, "wheel", fn, bubble || false); } else { var wname = (document.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox _modernWheelEvent(el, wname, fn, bubble || false); if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy } }; if (cap.haseventlistener) { // W3C standard event model this.bind = function(dom, name, fn, bubble) { // W3C var el = ("jquery" in dom) ? dom[0] : dom; self._bind(el, name, fn, bubble || false); }; this._bind = function(el, name, fn, bubble) { // primitive bind self.events.push({ e: el, n: name, f: fn, b: bubble, q: false }); el.addEventListener(name, fn, bubble || false); }; this.cancelEvent = function(e) { if (!e) return false; var e = (e.original) ? e.original : e; if (e.cancelable) e.preventDefault(); e.stopPropagation(); if (e.preventManipulation) e.preventManipulation(); //IE10 return false; }; this.stopPropagation = function(e) { if (!e) return false; var e = (e.original) ? e.original : e; e.stopPropagation(); return false; }; this._unbind = function(el, name, fn, bub) { // primitive unbind el.removeEventListener(name, fn, bub); }; } else { // old IE model this.bind = function(dom, name, fn, bubble) { // legacy IE var el = ("jquery" in dom) ? dom[0] : dom; self._bind(el, name, function(e) { e = e || window.event || false; if (e && e.srcElement) { e.target = e.srcElement; } if (!("pageY" in e)) { e.pageX = e.clientX + document.documentElement.scrollLeft; e.pageY = e.clientY + document.documentElement.scrollTop; } return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true; }); }; this._bind = function(el, name, fn, bubble) { // primitive bind self.events.push({ e: el, n: name, f: fn, b: bubble, q: false }); if (el.attachEvent) { el.attachEvent("on" + name, fn); } else { el["on" + name] = fn; } }; // Thanks to http://www.switchonthecode.com !! this.cancelEvent = function(e) { var e = window.event || false; if (!e) return false; e.cancelBubble = true; e.cancel = true; e.returnValue = false; return false; }; this.stopPropagation = function(e) { var e = window.event || false; if (!e) return false; e.cancelBubble = true; return false; }; this._unbind = function(el, name, fn, bub) { // primitive unbind IE old if (el.detachEvent) { el.detachEvent('on' + name, fn); } else { el['on' + name] = false; } }; } this.unbindAll = function() { for (var a = 0; a < self.events.length; a++) { var r = self.events[a]; (r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b); } }; this.showRail = function() { if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) { self.visibility = true; self.rail.visibility = true; self.rail.css('display', 'block'); } return self; }; this.showRailHr = function() { if (!self.railh) return self; if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) { self.railh.visibility = true; self.railh.css('display', 'block'); } return self; }; this.hideRail = function() { self.visibility = false; self.rail.visibility = false; self.rail.css('display', 'none'); return self; }; this.hideRailHr = function() { if (!self.railh) return self; self.railh.visibility = false; self.railh.css('display', 'none'); return self; }; this.show = function() { self.hidden = false; self.railslocked = false; return self.showRail().showRailHr(); }; this.hide = function() { self.hidden = true; self.railslocked = true; return self.hideRail().hideRailHr(); }; this.toggle = function() { return (self.hidden) ? self.show() : self.hide(); }; this.remove = function() { self.stop(); if (self.cursortimeout) clearTimeout(self.cursortimeout); // if (self.debouncedelayed) clearTimeout(self.debouncedelayed); for(var n in self.delaylist) if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h); self.doZoomOut(); self.unbindAll(); if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug if (self.observer !== false) self.observer.disconnect(); if (self.observerremover !== false) self.observerremover.disconnect(); if (self.observerbody !== false) self.observerbody.disconnect(); self.events = null; if (self.cursor) { self.cursor.remove(); } if (self.cursorh) { self.cursorh.remove(); } if (self.rail) { self.rail.remove(); } if (self.railh) { self.railh.remove(); } if (self.zoom) { self.zoom.remove(); } for (var a = 0; a < self.saved.css.length; a++) { var d = self.saved.css[a]; d[0].css(d[1], (d[2] === undefined) ? '' : d[2]); } self.saved = false; self.me.data('__nicescroll', ''); //erase all traces // memory leak fixed by GianlucaGuarini - thanks a lot! // remove the current nicescroll from the $.nicescroll array & normalize array var lst = $.nicescroll; lst.each(function(i) { if (!this) return; if (this.id === self.id) { delete lst[i]; for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b]; lst.length--; if (lst.length) delete lst[lst.length]; } }); for (var i in self) { self[i] = null; delete self[i]; } self = null; }; this.scrollstart = function(fn) { this.onscrollstart = fn; return self; }; this.scrollend = function(fn) { this.onscrollend = fn; return self; }; this.scrollcancel = function(fn) { this.onscrollcancel = fn; return self; }; this.zoomin = function(fn) { this.onzoomin = fn; return self; }; this.zoomout = function(fn) { this.onzoomout = fn; return self; }; this.isScrollable = function(e) { var dom = (e.target) ? e.target : e; if (dom.nodeName == 'OPTION') return true; while (dom && (dom.nodeType == 1) && (dom !== this.me[0]) && !(/^BODY|HTML/.test(dom.nodeName))) { var dd = $(dom); var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || ''; if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight); dom = (dom.parentNode) ? dom.parentNode : false; } return false; }; this.getViewport = function(me) { var dom = (me && me.parentNode) ? me.parentNode : false; while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) { var dd = $(dom); if (/fixed|absolute/.test(dd.css("position"))) return dd; var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || ''; if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd; if (dd.getNiceScroll().length > 0) return dd; dom = (dom.parentNode) ? dom.parentNode : false; } return false; //(dom) ? $(dom) : false; }; this.triggerScrollEnd = function() { if (!self.onscrollend) return; var px = self.getScrollLeft(); var py = self.getScrollTop(); var info = { type: "scrollend", current: { x: px, y: py }, end: { x: px, y: py } }; self.onscrollend.call(self, info); }; function execScrollWheel(e, hr, chkscroll) { var px, py; if (e.deltaMode == 0) { // PIXEL px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3))); py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3))); } else if (e.deltaMode == 1) { // LINE px = -Math.floor(e.deltaX * self.opt.mousescrollstep); py = -Math.floor(e.deltaY * self.opt.mousescrollstep); } if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support px = py; py = 0; if (chkscroll) { var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0); if (hrend) { // preserve vertical scrolling py = px; px = 0; } } } // invert horizontal direction for rtl mode if (self.isrtlmode) px = -px; if (px) { if (self.scrollmom) { self.scrollmom.stop(); } self.lastdeltax += px; self.debounced("mousewheelx", function() { var dt = self.lastdeltax; self.lastdeltax = 0; if (!self.rail.drag) { self.doScrollLeftBy(dt); } }, 15); } if (py) { if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) { if (py < 0) { if (self.getScrollTop() >= self.page.maxh) return true; } else { if (self.getScrollTop() <= 0) return true; } } if (self.scrollmom) { self.scrollmom.stop(); } self.lastdeltay += py; // self.debounced("mousewheely", function() { self.synched("mousewheely", function() { var dt = self.lastdeltay; self.lastdeltay = 0; if (!self.rail.drag) { self.doScrollBy(dt); } }, 15); } e.stopImmediatePropagation(); return e.preventDefault(); } this.onmousewheel = function(e) { if (self.wheelprevented) return; if (self.railslocked) { self.debounced("checkunlock", self.resize, 250); return true; } if (self.rail.drag) return self.cancelEvent(e); if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant) if (self.opt.oneaxismousemode && e.deltaX == 0) { if (!self.rail.scrollable) { if (self.railh && self.railh.scrollable) { return self.onmousewheelhr(e); } else { return true; } } } var nw = +(new Date()); var chk = false; if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) { self.nativescrollingarea = self.isScrollable(e); chk = true; } self.checkarea = nw; if (self.nativescrollingarea) return true; // this isn't my business var ret = execScrollWheel(e, false, chk); if (ret) self.checkarea = 0; return ret; }; this.onmousewheelhr = function(e) { if (self.wheelprevented) return; if (self.railslocked || !self.railh.scrollable) return true; if (self.rail.drag) return self.cancelEvent(e); var nw = +(new Date()); var chk = false; if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) { self.nativescrollingarea = self.isScrollable(e); chk = true; } self.checkarea = nw; if (self.nativescrollingarea) return true; // this isn't my business if (self.railslocked) return self.cancelEvent(e); return execScrollWheel(e, true, chk); }; this.stop = function() { self.cancelScroll(); if (self.scrollmon) self.scrollmon.stop(); self.cursorfreezed = false; self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y)); self.noticeCursor(); return self; }; this.getTransitionSpeed = function(dif) { var sp = Math.round(self.opt.scrollspeed * 10); var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed)); return (ex > 20) ? ex : 0; }; if (!self.opt.smoothscroll) { this.doScrollLeft = function(x, spd) { //direct var y = self.getScrollTop(); self.doScrollPos(x, y, spd); }; this.doScrollTop = function(y, spd) { //direct var x = self.getScrollLeft(); self.doScrollPos(x, y, spd); }; this.doScrollPos = function(x, y, spd) { //direct var nx = (x > self.page.maxw) ? self.page.maxw : x; if (nx < 0) nx = 0; var ny = (y > self.page.maxh) ? self.page.maxh : y; if (ny < 0) ny = 0; self.synched('scroll', function() { self.setScrollTop(ny); self.setScrollLeft(nx); }); }; this.cancelScroll = function() {}; // direct } else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) { this.prepareTransition = function(dif, istime) { var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif); var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : ''; if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) { self.lasttransitionstyle = trans; self.doc.css(cap.transitionstyle, trans); } return ex; }; this.doScrollLeft = function(x, spd) { //trans var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); self.doScrollPos(x, y, spd); }; this.doScrollTop = function(y, spd) { //trans var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); self.doScrollPos(x, y, spd); }; this.doScrollPos = function(x, y, spd) { //trans var py = self.getScrollTop(); var px = self.getScrollLeft(); if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection if (self.opt.bouncescroll == false) { if (y < 0) y = 0; else if (y > self.page.maxh) y = self.page.maxh; if (x < 0) x = 0; else if (x > self.page.maxw) x = self.page.maxw; } if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false; self.newscrolly = y; self.newscrollx = x; self.newscrollspeed = spd || false; if (self.timer) return false; self.timer = setTimeout(function() { var top = self.getScrollTop(); var lft = self.getScrollLeft(); var dst = {}; dst.x = x - lft; dst.y = y - top; dst.px = lft; dst.py = top; var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2))); var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd); if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed; self.prepareTransition(ms, true); if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm); if (ms > 0) { if (!self.scrollrunning && self.onscrollstart) { var info = { "type": "scrollstart", "current": { "x": lft, "y": top }, "request": { "x": x, "y": y }, "end": { "x": self.newscrollx, "y": self.newscrolly }, "speed": ms }; self.onscrollstart.call(self, info); } if (cap.transitionend) { if (!self.scrollendtrapped) { self.scrollendtrapped = true; self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!! } } else { if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped); self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event } var py = top; var px = lft; self.timerscroll = { bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1), bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1) }; if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() { self.showCursor(self.getScrollTop(), self.getScrollLeft()); }, 60); } self.synched("doScroll-set", function() { self.timer = 0; if (self.scrollendtrapped) self.scrollrunning = true; self.setScrollTop(self.newscrolly); self.setScrollLeft(self.newscrollx); if (!self.scrollendtrapped) self.onScrollTransitionEnd(); }); }, 50); }; this.cancelScroll = function() { if (!self.scrollendtrapped) return true; var py = self.getScrollTop(); var px = self.getScrollLeft(); self.scrollrunning = false; if (!cap.transitionend) clearTimeout(cap.transitionend); self.scrollendtrapped = false; self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd); self.prepareTransition(0); self.setScrollTop(py); // fire event onscroll if (self.railh) self.setScrollLeft(px); if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm); self.timerscroll = false; self.cursorfreezed = false; self.showCursor(py, px); return self; }; this.onScrollTransitionEnd = function() { if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd); self.scrollendtrapped = false; self.prepareTransition(0); if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm); self.timerscroll = false; var py = self.getScrollTop(); var px = self.getScrollLeft(); self.setScrollTop(py); // fire event onscroll if (self.railh) self.setScrollLeft(px); // fire event onscroll left self.noticeCursor(false, py, px); self.cursorfreezed = false; if (py < 0) py = 0; else if (py > self.page.maxh) py = self.page.maxh; if (px < 0) px = 0; else if (px > self.page.maxw) px = self.page.maxw; if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed); if (self.onscrollend && self.scrollrunning) { self.triggerScrollEnd(); } self.scrollrunning = false; }; } else { this.doScrollLeft = function(x, spd) { //no-trans var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); self.doScrollPos(x, y, spd); }; this.doScrollTop = function(y, spd) { //no-trans var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); self.doScrollPos(x, y, spd); }; this.doScrollPos = function(x, y, spd) { //no-trans var y = (y === undefined || y === false) ? self.getScrollTop(true) : y; if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true; if (self.timer) clearAnimationFrame(self.timer); self.timer = 0; var py = self.getScrollTop(); var px = self.getScrollLeft(); if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection self.newscrolly = y; self.newscrollx = x; if (!self.bouncescroll || !self.rail.visibility) { if (self.newscrolly < 0) { self.newscrolly = 0; } else if (self.newscrolly > self.page.maxh) { self.newscrolly = self.page.maxh; } } if (!self.bouncescroll || !self.railh.visibility) { if (self.newscrollx < 0) { self.newscrollx = 0; } else if (self.newscrollx > self.page.maxw) { self.newscrollx = self.page.maxw; } } self.dst = {}; self.dst.x = x - px; self.dst.y = y - py; self.dst.px = px; self.dst.py = py; var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2))); self.dst.ax = self.dst.x / dst; self.dst.ay = self.dst.y / dst; var pa = 0; var pe = dst; if (self.dst.x == 0) { pa = py; pe = y; self.dst.ay = 1; self.dst.py = 0; } else if (self.dst.y == 0) { pa = px; pe = x; self.dst.ax = 1; self.dst.px = 0; } var ms = self.getTransitionSpeed(dst); if (spd && spd <= 1) ms *= spd; if (ms > 0) { self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1); } else { self.bzscroll = false; } if (self.timer) return; if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize(); var sync = 1; function scrolling() { if (self.cancelAnimationFrame) return true; self.scrollrunning = true; sync = 1 - sync; if (sync) return (self.timer = setAnimationFrame(scrolling) || 1); var done = 0; var sx, sy; var sc = sy = self.getScrollTop(); if (self.dst.ay) { sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly; var dr = sc - sy; if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly; self.setScrollTop(sc); if (sc == self.newscrolly) done = 1; } else { done = 1; } var scx = sx = self.getScrollLeft(); if (self.dst.ax) { scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx; var dr = scx - sx; if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx; self.setScrollLeft(scx); if (scx == self.newscrollx) done += 1; } else { done += 1; } if (done == 2) { self.timer = 0; self.cursorfreezed = false; self.bzscroll = false; self.scrollrunning = false; if (sc < 0) sc = 0; else if (sc > self.page.maxh) sc = Math.max(0,self.page.maxh); if (scx < 0) scx = 0; else if (scx > self.page.maxw) scx = self.page.maxw; if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc); else { if (self.onscrollend) { self.triggerScrollEnd(); } } } else { self.timer = setAnimationFrame(scrolling) || 1; } } self.cancelAnimationFrame = false; self.timer = 1; if (self.onscrollstart && !self.scrollrunning) { var info = { "type": "scrollstart", "current": { "x": px, "y": py }, "request": { "x": x, "y": y }, "end": { "x": self.newscrollx, "y": self.newscrolly }, "speed": ms }; self.onscrollstart.call(self, info); } scrolling(); if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize(); self.noticeCursor(); }; this.cancelScroll = function() { if (self.timer) clearAnimationFrame(self.timer); self.timer = 0; self.bzscroll = false; self.scrollrunning = false; return self; }; } this.doScrollBy = function(stp, relative) { var ny = 0; if (relative) { ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y); } else { var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true); ny = sy - stp; } if (self.bouncescroll) { var haf = Math.round(self.view.h / 2); if (ny < -haf) ny = -haf; else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf); } self.cursorfreezed = false; var py = self.getScrollTop(true); if (ny < 0 && py <= 0) return self.noticeCursor(); else if (ny > self.page.maxh && py >= self.page.maxh) { self.checkContentSize(); return self.noticeCursor(); } self.doScrollTop(ny); }; this.doScrollLeftBy = function(stp, relative) { var nx = 0; if (relative) { nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x); } else { var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true); nx = sx - stp; } if (self.bouncescroll) { var haf = Math.round(self.view.w / 2); if (nx < -haf) nx = -haf; else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf); } self.cursorfreezed = false; var px = self.getScrollLeft(true); if (nx < 0 && px <= 0) return self.noticeCursor(); else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor(); self.doScrollLeft(nx); }; this.doScrollTo = function(pos, relative) { var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos; if (ny < 0) ny = 0; else if (ny > self.page.maxh) ny = self.page.maxh; self.cursorfreezed = false; self.doScrollTop(pos); }; this.checkContentSize = function() { var pg = self.getContentSize(); if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg); }; self.onscroll = function(e) { if (self.rail.drag) return; if (!self.cursorfreezed) { self.synched('scroll', function() { self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y)); if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x)); self.noticeCursor(); }); } }; self.bind(self.docscroll, "scroll", self.onscroll); this.doZoomIn = function(e) { if (self.zoomactive) return; self.zoomactive = true; self.zoomrestore = { style: {} }; var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight']; var win = self.win[0].style; for (var a in lst) { var pp = lst[a]; self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : ''; } self.zoomrestore.style.width = self.win.css('width'); self.zoomrestore.style.height = self.win.css('height'); self.zoomrestore.padding = { w: self.win.outerWidth() - self.win.width(), h: self.win.outerHeight() - self.win.height() }; if (cap.isios4) { self.zoomrestore.scrollTop = $(window).scrollTop(); $(window).scrollTop(0); } self.win.css({ position: (cap.isios4) ? "absolute" : "fixed", top: 0, left: 0, zIndex: globalmaxzindex + 100, margin: 0 }); var bkg = self.win.css("backgroundColor"); if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff"); self.rail.css({ zIndex: globalmaxzindex + 101 }); self.zoom.css({ zIndex: globalmaxzindex + 102 }); self.zoom.css('backgroundPosition', '0px -18px'); self.resizeZoom(); if (self.onzoomin) self.onzoomin.call(self); return self.cancelEvent(e); }; this.doZoomOut = function(e) { if (!self.zoomactive) return; self.zoomactive = false; self.win.css("margin", ""); self.win.css(self.zoomrestore.style); if (cap.isios4) { $(window).scrollTop(self.zoomrestore.scrollTop); } self.rail.css({ "z-index": self.zindex }); self.zoom.css({ "z-index": self.zindex }); self.zoomrestore = false; self.zoom.css('backgroundPosition', '0px 0px'); self.onResize(); if (self.onzoomout) self.onzoomout.call(self); return self.cancelEvent(e); }; this.doZoom = function(e) { return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e); }; this.resizeZoom = function() { if (!self.zoomactive) return; var py = self.getScrollTop(); //preserve scrolling position self.win.css({ width: $(window).width() - self.zoomrestore.padding.w + "px", height: $(window).height() - self.zoomrestore.padding.h + "px" }); self.onResize(); self.setScrollTop(Math.min(self.page.maxh, py)); }; this.init(); $.nicescroll.push(this); }; // Inspired by the work of Kin Blas // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js var ScrollMomentumClass2D = function(nc) { var self = this; this.nc = nc; this.lastx = 0; this.lasty = 0; this.speedx = 0; this.speedy = 0; this.lasttime = 0; this.steptime = 0; this.snapx = false; this.snapy = false; this.demulx = 0; this.demuly = 0; this.lastscrollx = -1; this.lastscrolly = -1; this.chkx = 0; this.chky = 0; this.timer = 0; this.time = function() { return +new Date(); //beautifull hack }; this.reset = function(px, py) { self.stop(); var now = self.time(); self.steptime = 0; self.lasttime = now; self.speedx = 0; self.speedy = 0; self.lastx = px; self.lasty = py; self.lastscrollx = -1; self.lastscrolly = -1; }; this.update = function(px, py) { var now = self.time(); self.steptime = now - self.lasttime; self.lasttime = now; var dy = py - self.lasty; var dx = px - self.lastx; var sy = self.nc.getScrollTop(); var sx = self.nc.getScrollLeft(); var newy = sy + dy; var newx = sx + dx; self.snapx = (newx < 0) || (newx > self.nc.page.maxw); self.snapy = (newy < 0) || (newy > self.nc.page.maxh); self.speedx = dx; self.speedy = dy; self.lastx = px; self.lasty = py; }; this.stop = function() { self.nc.unsynched("domomentum2d"); if (self.timer) clearTimeout(self.timer); self.timer = 0; self.lastscrollx = -1; self.lastscrolly = -1; }; this.doSnapy = function(nx, ny) { var snap = false; if (ny < 0) { ny = 0; snap = true; } else if (ny > self.nc.page.maxh) { ny = self.nc.page.maxh; snap = true; } if (nx < 0) { nx = 0; snap = true; } else if (nx > self.nc.page.maxw) { nx = self.nc.page.maxw; snap = true; } (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd(); }; this.doMomentum = function(gp) { var t = self.time(); var l = (gp) ? t + gp : self.lasttime; var sl = self.nc.getScrollLeft(); var st = self.nc.getScrollTop(); var pageh = self.nc.page.maxh; var pagew = self.nc.page.maxw; self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0; self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0; var chk = l && (t - l) <= 60; if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false; var sy = (self.speedy && chk) ? self.speedy : false; var sx = (self.speedx && chk) ? self.speedx : false; if (sy || sx) { var tm = Math.max(16, self.steptime); //timeout granularity if (tm > 50) { // do smooth var xm = tm / 50; self.speedx *= xm; self.speedy *= xm; tm = 50; } self.demulxy = 0; self.lastscrollx = self.nc.getScrollLeft(); self.chkx = self.lastscrollx; self.lastscrolly = self.nc.getScrollTop(); self.chky = self.lastscrolly; var nx = self.lastscrollx; var ny = self.lastscrolly; var onscroll = function() { var df = ((self.time() - t) > 600) ? 0.04 : 0.02; if (self.speedx) { nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy))); self.lastscrollx = nx; if ((nx < 0) || (nx > pagew)) df = 0.10; } if (self.speedy) { ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy))); self.lastscrolly = ny; if ((ny < 0) || (ny > pageh)) df = 0.10; } self.demulxy = Math.min(1, self.demulxy + df); self.nc.synched("domomentum2d", function() { if (self.speedx) { var scx = self.nc.getScrollLeft(); // if (scx != self.chkx) self.stop(); self.chkx = nx; self.nc.setScrollLeft(nx); } if (self.speedy) { var scy = self.nc.getScrollTop(); // if (scy != self.chky) self.stop(); self.chky = ny; self.nc.setScrollTop(ny); } if (!self.timer) { self.nc.hideCursor(); self.doSnapy(nx, ny); } }); if (self.demulxy < 1) { self.timer = setTimeout(onscroll, tm); } else { self.stop(); self.nc.hideCursor(); self.doSnapy(nx, ny); } }; onscroll(); } else { self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop()); } }; }; // override jQuery scrollTop var _scrollTop = jQuery.fn.scrollTop; // preserve original function jQuery.cssHooks.pageYOffset = { get: function(elem, computed, extra) { var nice = $.data(elem, '__nicescroll') || false; return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem); }, set: function(elem, value) { var nice = $.data(elem, '__nicescroll') || false; (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value); return this; } }; /* $.fx.step["scrollTop"] = function(fx){ $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit ); }; */ jQuery.fn.scrollTop = function(value) { if (value === undefined) { var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false; return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this); } else { return this.each(function() { var nice = $.data(this, '__nicescroll') || false; (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value); }); } }; // override jQuery scrollLeft var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function $.cssHooks.pageXOffset = { get: function(elem, computed, extra) { var nice = $.data(elem, '__nicescroll') || false; return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem); }, set: function(elem, value) { var nice = $.data(elem, '__nicescroll') || false; (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value); return this; } }; /* $.fx.step["scrollLeft"] = function(fx){ $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit ); }; */ jQuery.fn.scrollLeft = function(value) { if (value === undefined) { var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false; return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this); } else { return this.each(function() { var nice = $.data(this, '__nicescroll') || false; (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value); }); } }; var NiceScrollArray = function(doms) { var self = this; this.length = 0; this.name = "nicescrollarray"; this.each = function(fn) { $.each(self, fn); return self; }; this.push = function(nice) { self[self.length] = nice; self.length++; }; this.eq = function(idx) { return self[idx]; }; if (doms) { for (var a = 0; a < doms.length; a++) { var nice = $.data(doms[a], '__nicescroll') || false; if (nice) { this[this.length] = nice; this.length++; } } } return this; }; function mplex(el, lst, fn) { for (var a = 0; a < lst.length; a++) fn(el, lst[a]); } mplex( NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'], function(e, n) { e[n] = function() { var args = arguments; return this.each(function() { this[n].apply(this, args); }); }; } ); jQuery.fn.getNiceScroll = function(index) { if (index === undefined) { return new NiceScrollArray(this); } else { return this[index] && $.data(this[index], '__nicescroll') || false; } }; jQuery.expr[':'].nicescroll = function(a) { return $.data(a, '__nicescroll') !== undefined; }; $.fn.niceScroll = function(wrapper, opt) { if (opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) { opt = wrapper; wrapper = false; } opt = $.extend({},opt); // cloning var ret = new NiceScrollArray(); if (opt === undefined) opt = {}; if (wrapper || false) { opt.doc = $(wrapper); opt.win = $(this); } var docundef = !("doc" in opt); if (!docundef && !("win" in opt)) opt.win = $(this); this.each(function() { var nice = $(this).data('__nicescroll') || false; if (!nice) { opt.doc = (docundef) ? $(this) : opt.doc; nice = new NiceScrollClass(opt, $(this)); $(this).data('__nicescroll', nice); } ret.push(nice); }); return (ret.length == 1) ? ret[0] : ret; }; window.NiceScroll = { getjQuery: function() { return jQuery; } }; if (!$.nicescroll) { $.nicescroll = new NiceScrollArray(); $.nicescroll.options = _globaloptions; } }));
[-] infinitescroll.js
[edit]
[-] lightbox.min.js
[edit]
[+]
..
[-] infinitescroll.min.js
[edit]
[-] lightbox.js
[edit]
[-] nicescroll.min.js
[edit]
[-] html5.js
[edit]
[-] html5.min.js
[edit]
[-] magnific-popup.min.js
[edit]
[+]
woo
[+]
edd
[-] magnific-popup.js
[edit]
[-] nicescroll.js
[edit]